| Name | Azodicarboxylic Bismorpholide |
| Synonyms | NSC 356022 Azodicarboxylic Dimorpholide AZODICARBOXYLIC DIMORPHOLIDE AZODICARBOXYLIC BISMORPHOLIDE Azodicarboxylic Bismorpholide 4,4'-Azodicarbonylbis(morpholine) Diazene-1,2-diylbis(morpholinomethanone) diazene-1,2-diylbis(morpholin-4-ylmethanone) 4,4'-[(E)-diazene-1,2-diyldicarbonyl]dimorpholine Methanone,1,1'-(1,2-diazenediyl)bis[1-(4-morpholinyl)- |
| CAS | 10465-82-4 |
| EINECS | 418-690-0 |
| InChI | InChI=1/C10H16N4O4/c15-9(13-1-5-17-6-2-13)11-12-10(16)14-3-7-18-8-4-14/h1-8H2/b12-11+ |
| Molecular Formula | C10H16N4O4 |
| Molar Mass | 256.26 |
| Density | 1.46±0.1 g/cm3(Predicted) |
| Melting Point | 141-143 °C |
| Boling Point | 397.6±52.0 °C(Predicted) |
| Flash Point | 194.3°C |
| Vapor Presure | 1.56E-06mmHg at 25°C |
| BRN | 1013753 |
| pKa | -0.97±0.20(Predicted) |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | 1.626 |
| MDL | MFCD00043006 |
| Physical and Chemical Properties | WGK Germany:3 |
| Use | Reagents for the synthesis of symmetric and asymmetric disulfides in polar solvents such as water |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| Use | Reagents for the synthesis of symmetric and asymmetric disulfides in polar solvents (such as water) |